C10H19NO4S2 — CID 176706752
ethane;methyl 5-methylsulfonyl-1,3-thiazole-2-carboxylate (PubChem CID 176706752) has the molecular formula C10H19NO4S2 and a molecular weight of 281.40 g/mol. Its IUPAC name is ethane;methyl 5-methylsulfonyl-1,3-thiazole-2-carboxylate.
| Compound Name | ethane;methyl 5-methylsulfonyl-1,3-thiazole-2-carboxylate |
|---|---|
| PubChem CID | 176706752 |
| Molecular Formula | C10H19NO4S2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | ethane;methyl 5-methylsulfonyl-1,3-thiazole-2-carboxylate |
| SMILES | CC.CC.COC(=O)c1ncc(S(C)(=O)=O)s1 |
| InChI | InChI=1S/C6H7NO4S2.2C2H6/c1-11-6(8)5-7-3-4(12-5)13(2,9)10;2*1-2/h3H,1-2H3;2*1-2H3 |
| InChIKey | VHIITHZMSFSSHR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |