C22H30N8O2 — CID 176706831
2-[4-[2-[4-(1,4-diamino-1,4-diiminobutan-2-yl)phenoxy]ethoxy]phenyl]butanediimidamide (PubChem CID 176706831) has the molecular formula C22H30N8O2 and a molecular weight of 438.54 g/mol. Its IUPAC name is 2-[4-[2-[4-(1,4-diamino-1,4-diiminobutan-2-yl)phenoxy]ethoxy]phenyl]butanediimidamide.
| Compound Name | 2-[4-[2-[4-(1,4-diamino-1,4-diiminobutan-2-yl)phenoxy]ethoxy]phenyl]butanediimidamide |
|---|---|
| PubChem CID | 176706831 |
| Molecular Formula | C22H30N8O2 |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | 2-[4-[2-[4-(1,4-diamino-1,4-diiminobutan-2-yl)phenoxy]ethoxy]phenyl]butanediimidamide |
| SMILES | [H]/N=C(\N)CC(/C(N)=N/[H])c1ccc(OCCOc2ccc(C(C/C(N)=N/[H])/C(N)=N/[H])cc2)cc1 |
| InChI | InChI=1S/C22H30N8O2/c23-19(24)11-17(21(27)28)13-1-5-15(6-2-13)31-9-10-32-16-7-3-14(4-8-16)18(22(29)30)12-20(25)26/h1-8,17-18H,9-12H2,(H3,23,24)(H3,25,26)(H3,27,28)(H3,29,30) |
| InChIKey | YCYKRAZDCDYDHR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 217.94 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|