C21H29N5O2 — CID 176708330
3-[cyclopropyl-[(5-ethyl-1H-indol-2-yl)methylcarbamoyl]amino]piperidine-1-carboxamide (PubChem CID 176708330) has the molecular formula C21H29N5O2 and a molecular weight of 383.50 g/mol. Its IUPAC name is 3-[cyclopropyl-[(5-ethyl-1H-indol-2-yl)methylcarbamoyl]amino]piperidine-1-carboxamide.
| Compound Name | 3-[cyclopropyl-[(5-ethyl-1H-indol-2-yl)methylcarbamoyl]amino]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 176708330 |
| Molecular Formula | C21H29N5O2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | 3-[cyclopropyl-[(5-ethyl-1H-indol-2-yl)methylcarbamoyl]amino]piperidine-1-carboxamide |
| SMILES | CCc1ccc2[nH]c(CNC(=O)N(C3CC3)C3CCCN(C(N)=O)C3)cc2c1 |
| InChI | InChI=1S/C21H29N5O2/c1-2-14-5-8-19-15(10-14)11-16(24-19)12-23-21(28)26(17-6-7-17)18-4-3-9-25(13-18)20(22)27/h5,8,10-11,17-18,24H,2-4,6-7,9,12-13H2,1H3,(H2,22,27)(H,23,28) |
| InChIKey | PVYCKCQBZSPLBD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |