C21H26OS — CID 176708794
S-ethyl 2-[2-(2,3-dimethylbutan-2-yl)phenyl]benzenecarbothioate (PubChem CID 176708794) has the molecular formula C21H26OS and a molecular weight of 326.51 g/mol. Its IUPAC name is S-ethyl 2-[2-(2,3-dimethylbutan-2-yl)phenyl]benzenecarbothioate.
| Compound Name | S-ethyl 2-[2-(2,3-dimethylbutan-2-yl)phenyl]benzenecarbothioate |
|---|---|
| PubChem CID | 176708794 |
| Molecular Formula | C21H26OS |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | S-ethyl 2-[2-(2,3-dimethylbutan-2-yl)phenyl]benzenecarbothioate |
| SMILES | CCSC(=O)c1ccccc1-c1ccccc1C(C)(C)C(C)C |
| InChI | InChI=1S/C21H26OS/c1-6-23-20(22)18-13-8-7-11-16(18)17-12-9-10-14-19(17)21(4,5)15(2)3/h7-15H,6H2,1-5H3 |
| InChIKey | ICQXPHGQIWVFGO-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|