About S-ethyl 2-[2-(3-phenyl-3-sulfanylpropyl)phenyl]benzenecarbothioate
S-ethyl 2-[2-(3-phenyl-3-sulfanylpropyl)phenyl]benzenecarbothioate (PubChem CID 176747669) has the molecular formula C24H24OS2
and a molecular weight of 392.59 g/mol. Its IUPAC name is S-ethyl 2-[2-(3-phenyl-3-sulfanylpropyl)phenyl]benzenecarbothioate.
Molecular Properties
| Compound Name | S-ethyl 2-[2-(3-phenyl-3-sulfanylpropyl)phenyl]benzenecarbothioate |
| PubChem CID | 176747669 |
| Molecular Formula | C24H24OS2 |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | S-ethyl 2-[2-(3-phenyl-3-sulfanylpropyl)phenyl]benzenecarbothioate |
| SMILES | CCSC(=O)c1ccccc1-c1ccccc1CCC(S)c1ccccc1 |
| InChI | InChI=1S/C24H24OS2/c1-2-27-24(25)22-15-9-8-14-21(22)20-13-7-6-10-18(20)16-17-23(26)19-11-4-3-5-12-19/h3-15,23,26H,2,16-17H2,1H3 |
| InChIKey | PSDLIXUEAUVRTD-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze S-ethyl 2-[2-(3-phenyl-3-sulfanylpropyl)phenyl]benzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-ethyl 2-[2-(3-phenyl-3-sulfanylpropyl)phenyl]benzenecarbothioate?
The IUPAC name of S-ethyl 2-[2-(3-phenyl-3-sulfanylpropyl)phenyl]benzenecarbothioate (CID 176747669) is S-ethyl 2-[2-(3-phenyl-3-sulfanylpropyl)phenyl]benzenecarbothioate.
What is the SMILES notation for S-ethyl 2-[2-(3-phenyl-3-sulfanylpropyl)phenyl]benzenecarbothioate?
The canonical SMILES for S-ethyl 2-[2-(3-phenyl-3-sulfanylpropyl)phenyl]benzenecarbothioate is CCSC(=O)c1ccccc1-c1ccccc1CCC(S)c1ccccc1.
What is the InChIKey of S-ethyl 2-[2-(3-phenyl-3-sulfanylpropyl)phenyl]benzenecarbothioate?
The InChIKey is PSDLIXUEAUVRTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24OS2/c1-2-27-24(25)22-15-9-8-14-21(22)20-13-7-6-10-18(20)16-17-23(26)19-11-4-3-5-12-19/h3-15,23,26H,2,16-17H2,1H3.
What are the key properties of S-ethyl 2-[2-(3-phenyl-3-sulfanylpropyl)phenyl]benzenecarbothioate?
S-ethyl 2-[2-(3-phenyl-3-sulfanylpropyl)phenyl]benzenecarbothioate has a molecular weight of 392.59 g/mol, XLogP of 6.85, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-ethyl 2-[2-(3-phenyl-3-sulfanylpropyl)phenyl]benzenecarbothioate is sourced from PubChem (CID 176747669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).