C22H16F2N6O5 — CID 176711671
18-(difluoromethoxy)-5-pyrimidin-5-yl-12-(trihydroxymethyl)-6,8,9,12-tetrazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-2,4,6,9,14(19),15,17-heptaen-13-one (PubChem CID 176711671) has the molecular formula C22H16F2N6O5 and a molecular weight of 482.40 g/mol. Its IUPAC name is 18-(difluoromethoxy)-5-pyrimidin-5-yl-12-(trihydroxymethyl)-6,8,9,12-tetrazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-2,4,6,9,14(19),15,17-heptaen-13-one.
| Compound Name | 18-(difluoromethoxy)-5-pyrimidin-5-yl-12-(trihydroxymethyl)-6,8,9,12-tetrazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-2,4,6,9,14(19),15,17-heptaen-13-one |
|---|---|
| PubChem CID | 176711671 |
| Molecular Formula | C22H16F2N6O5 |
| Molecular Weight | 482.40 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | 18-(difluoromethoxy)-5-pyrimidin-5-yl-12-(trihydroxymethyl)-6,8,9,12-tetrazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-2,4,6,9,14(19),15,17-heptaen-13-one |
| SMILES | O=C1c2cccc(OC(F)F)c2C2CC(c3nn4cnc(-c5cncnc5)cc4c32)N1C(O)(O)O |
| InChI | InChI=1S/C22H16F2N6O5/c23-21(24)35-16-3-1-2-11-17(16)12-4-15(30(20(11)31)22(32,33)34)19-18(12)14-5-13(27-9-29(14)28-19)10-6-25-8-26-7-10/h1-3,5-9,12,15,21,32-34H,4H2 |
| InChIKey | AGOYTDHCHHOHFK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 146.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.40 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|