C29H41N5 — CID 176712517
18-amino-5-ethyl-14-methyl-7-[2-(2-methylbutan-2-yl)azetidin-1-yl]-4,6-diazatricyclo[13.4.0.03,8]nonadeca-1(15),3(8),4,6,16,18-hexaene-19-carbonitrile (PubChem CID 176712517) has the molecular formula C29H41N5 and a molecular weight of 459.68 g/mol. Its IUPAC name is 18-amino-5-ethyl-14-methyl-7-[2-(2-methylbutan-2-yl)azetidin-1-yl]-4,6-diazatricyclo[13.4.0.03,8]nonadeca-1(15),3(8),4,6,16,18-hexaene-19-carbonitrile.
| Compound Name | 18-amino-5-ethyl-14-methyl-7-[2-(2-methylbutan-2-yl)azetidin-1-yl]-4,6-diazatricyclo[13.4.0.03,8]nonadeca-1(15),3(8),4,6,16,18-hexaene-19-carbonitrile |
|---|---|
| PubChem CID | 176712517 |
| Molecular Formula | C29H41N5 |
| Molecular Weight | 459.68 g/mol |
| Exact Mass | 459.34 |
| IUPAC Name | 18-amino-5-ethyl-14-methyl-7-[2-(2-methylbutan-2-yl)azetidin-1-yl]-4,6-diazatricyclo[13.4.0.03,8]nonadeca-1(15),3(8),4,6,16,18-hexaene-19-carbonitrile |
| SMILES | CCc1nc2c(c(N3CCC3C(C)(C)CC)n1)CCCCCC(C)c1ccc(N)c(C#N)c1C2 |
| InChI | InChI=1S/C29H41N5/c1-6-27-32-25-17-22-20(13-14-24(31)23(22)18-30)19(3)11-9-8-10-12-21(25)28(33-27)34-16-15-26(34)29(4,5)7-2/h13-14,19,26H,6-12,15-17,31H2,1-5H3 |
| InChIKey | LPWRZKDDKQVVQU-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 78.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.68 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|