C32H41FN6 — CID 176712552
2-amino-2'-[2-(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethyl]-5-methyl-4'-pyrrolidin-1-ylspiro[6,7-dihydro-5H-naphthalene-8,7'-6,8-dihydro-5H-quinazoline]-1-carbonitrile (PubChem CID 176712552) has the molecular formula C32H41FN6 and a molecular weight of 528.72 g/mol. Its IUPAC name is 2-amino-2'-[2-(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethyl]-5-methyl-4'-pyrrolidin-1-ylspiro[6,7-dihydro-5H-naphthalene-8,7'-6,8-dihydro-5H-quinazoline]-1-carbonitrile.
| Compound Name | 2-amino-2'-[2-(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethyl]-5-methyl-4'-pyrrolidin-1-ylspiro[6,7-dihydro-5H-naphthalene-8,7'-6,8-dihydro-5H-quinazoline]-1-carbonitrile |
|---|---|
| PubChem CID | 176712552 |
| Molecular Formula | C32H41FN6 |
| Molecular Weight | 528.72 g/mol |
| Exact Mass | 528.34 |
| IUPAC Name | 2-amino-2'-[2-(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethyl]-5-methyl-4'-pyrrolidin-1-ylspiro[6,7-dihydro-5H-naphthalene-8,7'-6,8-dihydro-5H-quinazoline]-1-carbonitrile |
| SMILES | CC1CCC2(CCc3c(nc(CCC45CCCN4CC(F)C5)nc3N3CCCC3)C2)c2c1ccc(N)c2C#N |
| InChI | InChI=1S/C32H41FN6/c1-21-7-11-31(29-23(21)5-6-26(35)25(29)19-34)12-8-24-27(18-31)36-28(37-30(24)38-14-2-3-15-38)9-13-32-10-4-16-39(32)20-22(33)17-32/h5-6,21-22H,2-4,7-18,20,35H2,1H3 |
| InChIKey | YUZKYGZWBGBHAZ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 82.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.72 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|