C20H29N9O — CID 176723666
2-[3-[(9aR)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-1-[2-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]amino]pyrimidin-4-yl]azetidin-3-yl]acetonitrile (PubChem CID 176723666) has the molecular formula C20H29N9O and a molecular weight of 411.51 g/mol. Its IUPAC name is 2-[3-[(9aR)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-1-[2-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]amino]pyrimidin-4-yl]azetidin-3-yl]acetonitrile.
| Compound Name | 2-[3-[(9aR)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-1-[2-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]amino]pyrimidin-4-yl]azetidin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 176723666 |
| Molecular Formula | C20H29N9O |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | 2-[3-[(9aR)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-1-[2-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]amino]pyrimidin-4-yl]azetidin-3-yl]acetonitrile |
| SMILES | C/N=C/C(=C\N)Nc1nccc(N2CC(CC#N)(N3CCN4CCOC[C@H]4C3)C2)n1 |
| InChI | InChI=1S/C20H29N9O/c1-23-11-16(10-22)25-19-24-5-2-18(26-19)28-14-20(15-28,3-4-21)29-7-6-27-8-9-30-13-17(27)12-29/h2,5,10-11,17H,3,6-9,12-15,22H2,1H3,(H,24,25,26)/b16-10+,23-11+/t17-/m1/s1 |
| InChIKey | QVBCEBTYHLLYMX-AVSXJMCDSA-N |
| XLogP | -0.12 |
| TPSA | 118.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|