C21H31N9 — CID 176723694
2-[3-[(9aS)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-1-[2-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]amino]pyrimidin-4-yl]azetidin-3-yl]acetonitrile (PubChem CID 176723694) has the molecular formula C21H31N9 and a molecular weight of 409.54 g/mol. Its IUPAC name is 2-[3-[(9aS)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-1-[2-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]amino]pyrimidin-4-yl]azetidin-3-yl]acetonitrile.
| Compound Name | 2-[3-[(9aS)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-1-[2-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]amino]pyrimidin-4-yl]azetidin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 176723694 |
| Molecular Formula | C21H31N9 |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | 2-[3-[(9aS)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-1-[2-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]amino]pyrimidin-4-yl]azetidin-3-yl]acetonitrile |
| SMILES | C/N=C/C(=C\N)Nc1nccc(N2CC(CC#N)(N3CCN4CCCC[C@H]4C3)C2)n1 |
| InChI | InChI=1S/C21H31N9/c1-24-13-17(12-23)26-20-25-8-5-19(27-20)29-15-21(16-29,6-7-22)30-11-10-28-9-3-2-4-18(28)14-30/h5,8,12-13,18H,2-4,6,9-11,14-16,23H2,1H3,(H,25,26,27)/b17-12+,24-13+/t18-/m0/s1 |
| InChIKey | NKZCTBSQZFMWGW-ASYXHYJHSA-N |
| XLogP | 1.03 |
| TPSA | 109.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|