C23H22FN2O3+ — CID 176732514
3-(3,4-dimethoxyphenyl)-N-[1-[(3-fluorophenyl)methyl]pyridin-1-ium-4-yl]prop-2-enamide (PubChem CID 176732514) has the molecular formula C23H22FN2O3+ and a molecular weight of 393.44 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-[1-[(3-fluorophenyl)methyl]pyridin-1-ium-4-yl]prop-2-enamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-[1-[(3-fluorophenyl)methyl]pyridin-1-ium-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 176732514 |
| Molecular Formula | C23H22FN2O3+ |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-[1-[(3-fluorophenyl)methyl]pyridin-1-ium-4-yl]prop-2-enamide |
| SMILES | COc1ccc(C=CC(=O)Nc2cc[n+](Cc3cccc(F)c3)cc2)cc1OC |
| InChI | InChI=1S/C23H21FN2O3/c1-28-21-8-6-17(15-22(21)29-2)7-9-23(27)25-20-10-12-26(13-11-20)16-18-4-3-5-19(24)14-18/h3-15H,16H2,1-2H3/p+1 |
| InChIKey | QOEIFKBUDHUWRG-UHFFFAOYSA-O |
| XLogP | 3.83 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|