C22H40O2 — CID 176732801
(5R,6E,9Z,11R)-5,7,9,11-tetramethyloctadeca-6,9-dienoic acid (PubChem CID 176732801) has the molecular formula C22H40O2 and a molecular weight of 336.56 g/mol. Its IUPAC name is (5R,6E,9Z,11R)-5,7,9,11-tetramethyloctadeca-6,9-dienoic acid.
| Compound Name | (5R,6E,9Z,11R)-5,7,9,11-tetramethyloctadeca-6,9-dienoic acid |
|---|---|
| PubChem CID | 176732801 |
| Molecular Formula | C22H40O2 |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.30 |
| IUPAC Name | (5R,6E,9Z,11R)-5,7,9,11-tetramethyloctadeca-6,9-dienoic acid |
| SMILES | CCCCCCC[C@@H](C)/C=C(/C)C/C(C)=C/[C@H](C)CCCC(=O)O |
| InChI | InChI=1S/C22H40O2/c1-6-7-8-9-10-12-18(2)15-20(4)17-21(5)16-19(3)13-11-14-22(23)24/h15-16,18-19H,6-14,17H2,1-5H3,(H,23,24)/b20-15-,21-16+/t18-,19-/m1/s1 |
| InChIKey | AWAYURYLOOUACG-WXTUUIRSSA-N |
| XLogP | 7.16 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|