C20H24F4N6O — CID 176735274
5-[(3S)-4,4-difluoropyrrolidin-3-yl]-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-N-methylpyrido[4,3-d]pyrimidin-4-amine (PubChem CID 176735274) has the molecular formula C20H24F4N6O and a molecular weight of 440.45 g/mol. Its IUPAC name is 5-[(3S)-4,4-difluoropyrrolidin-3-yl]-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-N-methylpyrido[4,3-d]pyrimidin-4-amine.
| Compound Name | 5-[(3S)-4,4-difluoropyrrolidin-3-yl]-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-N-methylpyrido[4,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 176735274 |
| Molecular Formula | C20H24F4N6O |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 5-[(3S)-4,4-difluoropyrrolidin-3-yl]-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-N-methylpyrido[4,3-d]pyrimidin-4-amine |
| SMILES | CNc1nc(OC[C@@]23CCCN2C[C@H](F)C3)nc2c(F)cnc([C@@H]3CNCC3(F)F)c12 |
| InChI | InChI=1S/C20H24F4N6O/c1-25-17-14-15(12-6-26-9-20(12,23)24)27-7-13(22)16(14)28-18(29-17)31-10-19-3-2-4-30(19)8-11(21)5-19/h7,11-12,26H,2-6,8-10H2,1H3,(H,25,28,29)/t11-,12+,19+/m1/s1 |
| InChIKey | HADJTLHKRDYRDE-UFYHVXEKSA-N |
| XLogP | 2.48 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |