C33H39N9O4Zn — CID 176736610
2-[28-(carboxymethyl)-16-phenyl-1,10,11,12,20,23,28,31,32-nonazapentacyclo[18.5.5.13,7.114,18.08,12]dotriaconta-3(32),4,6,8,10,14(31),15,17-octaen-23-yl]acetic acid;zinc (PubChem CID 176736610) has the molecular formula C33H39N9O4Zn and a molecular weight of 691.12 g/mol. Its IUPAC name is 2-[28-(carboxymethyl)-16-phenyl-1,10,11,12,20,23,28,31,32-nonazapentacyclo[18.5.5.13,7.114,18.08,12]dotriaconta-3(32),4,6,8,10,14(31),15,17-octaen-23-yl]acetic acid;zinc.
| Compound Name | 2-[28-(carboxymethyl)-16-phenyl-1,10,11,12,20,23,28,31,32-nonazapentacyclo[18.5.5.13,7.114,18.08,12]dotriaconta-3(32),4,6,8,10,14(31),15,17-octaen-23-yl]acetic acid;zinc |
|---|---|
| PubChem CID | 176736610 |
| Molecular Formula | C33H39N9O4Zn |
| Molecular Weight | 691.12 g/mol |
| Exact Mass | 689.24 |
| IUPAC Name | 2-[28-(carboxymethyl)-16-phenyl-1,10,11,12,20,23,28,31,32-nonazapentacyclo[18.5.5.13,7.114,18.08,12]dotriaconta-3(32),4,6,8,10,14(31),15,17-octaen-23-yl]acetic acid;zinc |
| SMILES | O=C(O)CN1CCN2CCN(CC(=O)O)CCN(CC1)Cc1cccc(n1)-c1cnnn1Cc1cc(-c3ccccc3)cc(n1)C2.[Zn] |
| InChI | InChI=1S/C33H39N9O4.Zn/c43-32(44)23-40-13-9-38-10-14-41(24-33(45)46)16-12-39(11-15-40)21-28-17-26(25-5-2-1-3-6-25)18-29(35-28)22-42-31(19-34-37-42)30-8-4-7-27(20-38)36-30;/h1-8,17-19H,9-16,20-24H2,(H,43,44)(H,45,46); |
| InChIKey | VNMZZVNDXBGCAM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 144.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.12 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|