C15H18FNSe — CID 176737484
3-ethyl-8-fluoro-7-methyl-1,2,4,5-tetrahydro-[1]benzoselenolo[2,3-d]azepine (PubChem CID 176737484) has the molecular formula C15H18FNSe and a molecular weight of 310.27 g/mol. Its IUPAC name is 3-ethyl-8-fluoro-7-methyl-1,2,4,5-tetrahydro-[1]benzoselenolo[2,3-d]azepine.
| Compound Name | 3-ethyl-8-fluoro-7-methyl-1,2,4,5-tetrahydro-[1]benzoselenolo[2,3-d]azepine |
|---|---|
| PubChem CID | 176737484 |
| Molecular Formula | C15H18FNSe |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 3-ethyl-8-fluoro-7-methyl-1,2,4,5-tetrahydro-[1]benzoselenolo[2,3-d]azepine |
| SMILES | CCN1CCc2[se]c3c(C)c(F)ccc3c2CC1 |
| InChI | InChI=1S/C15H18FNSe/c1-3-17-8-6-11-12-4-5-13(16)10(2)15(12)18-14(11)7-9-17/h4-5H,3,6-9H2,1-2H3 |
| InChIKey | SZDLPIUXTRYASC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|