C10H11BrFN — CID 172639292
4-bromo-1-ethyl-7-fluoro-2,3-dihydroindole (PubChem CID 172639292) has the molecular formula C10H11BrFN and a molecular weight of 244.11 g/mol. Its IUPAC name is 4-bromo-1-ethyl-7-fluoro-2,3-dihydroindole.
| Compound Name | 4-bromo-1-ethyl-7-fluoro-2,3-dihydroindole |
|---|---|
| PubChem CID | 172639292 |
| Molecular Formula | C10H11BrFN |
| Molecular Weight | 244.11 g/mol |
| Exact Mass | 243.01 |
| IUPAC Name | 4-bromo-1-ethyl-7-fluoro-2,3-dihydroindole |
| SMILES | CCN1CCc2c(Br)ccc(F)c21 |
| InChI | InChI=1S/C10H11BrFN/c1-2-13-6-5-7-8(11)3-4-9(12)10(7)13/h3-4H,2,5-6H2,1H3 |
| InChIKey | RFOOYNVZMXXZBC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.11 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |