About 5-bromo-8-fluoro-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide
5-bromo-8-fluoro-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide (PubChem CID 75477685) has the molecular formula C11H14BrFN2O2S
and a molecular weight of 337.21 g/mol. Its IUPAC name is 5-bromo-8-fluoro-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide.
Molecular Properties
| Compound Name | 5-bromo-8-fluoro-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide |
| PubChem CID | 75477685 |
| Molecular Formula | C11H14BrFN2O2S |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | 5-bromo-8-fluoro-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCc2c(Br)ccc(F)c2C1 |
| InChI | InChI=1S/C11H14BrFN2O2S/c1-14(2)18(16,17)15-6-5-8-9(7-15)11(13)4-3-10(8)12/h3-4H,5-7H2,1-2H3 |
| InChIKey | ONMGFGPUAOMTDD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-8-fluoro-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-8-fluoro-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide?
The IUPAC name of 5-bromo-8-fluoro-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide (CID 75477685) is 5-bromo-8-fluoro-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide.
What is the SMILES notation for 5-bromo-8-fluoro-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide?
The canonical SMILES for 5-bromo-8-fluoro-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide is CN(C)S(=O)(=O)N1CCc2c(Br)ccc(F)c2C1.
What is the InChIKey of 5-bromo-8-fluoro-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide?
The InChIKey is ONMGFGPUAOMTDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14BrFN2O2S/c1-14(2)18(16,17)15-6-5-8-9(7-15)11(13)4-3-10(8)12/h3-4H,5-7H2,1-2H3.
What are the key properties of 5-bromo-8-fluoro-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide?
5-bromo-8-fluoro-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide has a molecular weight of 337.21 g/mol, XLogP of 1.75, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-8-fluoro-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide is sourced from PubChem (CID 75477685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).