C9H9BrFN — CID 63272497
8-bromo-5-fluoro-1,2,3,4-tetrahydroisoquinoline (PubChem CID 63272497) has the molecular formula C9H9BrFN and a molecular weight of 230.08 g/mol. Its IUPAC name is 8-bromo-5-fluoro-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 8-bromo-5-fluoro-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 63272497 |
| Molecular Formula | C9H9BrFN |
| Molecular Weight | 230.08 g/mol |
| Exact Mass | 228.99 |
| IUPAC Name | 8-bromo-5-fluoro-1,2,3,4-tetrahydroisoquinoline |
| SMILES | Fc1ccc(Br)c2c1CCNC2 |
| InChI | InChI=1S/C9H9BrFN/c10-8-1-2-9(11)6-3-4-12-5-7(6)8/h1-2,12H,3-5H2 |
| InChIKey | VVZOZQVEJFKOPE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.08 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |