C13H12F4N4 — CID 176738855
2-tert-butyl-7-(1,1,2,2-tetrafluoroethyl)imidazo[1,2-c]pyrimidine-3-carbonitrile (PubChem CID 176738855) has the molecular formula C13H12F4N4 and a molecular weight of 300.26 g/mol. Its IUPAC name is 2-tert-butyl-7-(1,1,2,2-tetrafluoroethyl)imidazo[1,2-c]pyrimidine-3-carbonitrile.
| Compound Name | 2-tert-butyl-7-(1,1,2,2-tetrafluoroethyl)imidazo[1,2-c]pyrimidine-3-carbonitrile |
|---|---|
| PubChem CID | 176738855 |
| Molecular Formula | C13H12F4N4 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 2-tert-butyl-7-(1,1,2,2-tetrafluoroethyl)imidazo[1,2-c]pyrimidine-3-carbonitrile |
| SMILES | CC(C)(C)c1nc2cc(C(F)(F)C(F)F)ncn2c1C#N |
| InChI | InChI=1S/C13H12F4N4/c1-12(2,3)10-7(5-18)21-6-19-8(4-9(21)20-10)13(16,17)11(14)15/h4,6,11H,1-3H3 |
| InChIKey | BHKULWZMQQCYTQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|