C26H30N2O5 — CID 176741837
ethyl 2-[4-[(E)-2-ethoxyethenyl]-5-[(3-phenylmethoxycyclobutyl)amino]-1,2-benzoxazol-3-yl]acetate (PubChem CID 176741837) has the molecular formula C26H30N2O5 and a molecular weight of 450.54 g/mol. Its IUPAC name is ethyl 2-[4-[(E)-2-ethoxyethenyl]-5-[(3-phenylmethoxycyclobutyl)amino]-1,2-benzoxazol-3-yl]acetate.
| Compound Name | ethyl 2-[4-[(E)-2-ethoxyethenyl]-5-[(3-phenylmethoxycyclobutyl)amino]-1,2-benzoxazol-3-yl]acetate |
|---|---|
| PubChem CID | 176741837 |
| Molecular Formula | C26H30N2O5 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | ethyl 2-[4-[(E)-2-ethoxyethenyl]-5-[(3-phenylmethoxycyclobutyl)amino]-1,2-benzoxazol-3-yl]acetate |
| SMILES | CCO/C=C/c1c(NC2CC(OCc3ccccc3)C2)ccc2onc(CC(=O)OCC)c12 |
| InChI | InChI=1S/C26H30N2O5/c1-3-30-13-12-21-22(10-11-24-26(21)23(28-33-24)16-25(29)31-4-2)27-19-14-20(15-19)32-17-18-8-6-5-7-9-18/h5-13,19-20,27H,3-4,14-17H2,1-2H3/b13-12+ |
| InChIKey | MRMPCSFZUHBZAZ-OUKQBFOZSA-N |
| XLogP | 5.10 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|