C38H22O2 — CID 176743099
5-[1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)anthracen-9-yl]-[1]benzofuro[2,3-e][1]benzofuran (PubChem CID 176743099) has the molecular formula C38H22O2 and a molecular weight of 525.68 g/mol. Its IUPAC name is 5-[1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)anthracen-9-yl]-[1]benzofuro[2,3-e][1]benzofuran.
| Compound Name | 5-[1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)anthracen-9-yl]-[1]benzofuro[2,3-e][1]benzofuran |
|---|---|
| PubChem CID | 176743099 |
| Molecular Formula | C38H22O2 |
| Molecular Weight | 525.68 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | 5-[1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)anthracen-9-yl]-[1]benzofuro[2,3-e][1]benzofuran |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3c4c([2H])c([2H])c([2H])c([2H])c4c(-c4cc5occc5c5oc6ccccc6c45)c4c([2H])c([2H])c([2H])c([2H])c34)c([2H])c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C38H22O2/c1-2-12-24-23(10-1)11-9-18-25(24)35-26-13-3-5-15-28(26)36(29-16-6-4-14-27(29)35)32-22-34-31(20-21-39-34)38-37(32)30-17-7-8-19-33(30)40-38/h1-22H/i1D,2D,3D,4D,5D,6D,9D,10D,11D,12D,13D,14D,15D,16D,18D |
| InChIKey | QMTCSQIRPIJMEC-CLCATXLUSA-N |
| XLogP | 11.13 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.68 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|