C23H17NO — CID 176749058
2-deuterio-15-(3,5-dimethylphenyl)-17-oxa-14-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12,14-octaene (PubChem CID 176749058) has the molecular formula C23H17NO and a molecular weight of 324.40 g/mol. Its IUPAC name is 2-deuterio-15-(3,5-dimethylphenyl)-17-oxa-14-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12,14-octaene.
| Compound Name | 2-deuterio-15-(3,5-dimethylphenyl)-17-oxa-14-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12,14-octaene |
|---|---|
| PubChem CID | 176749058 |
| Molecular Formula | C23H17NO |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 2-deuterio-15-(3,5-dimethylphenyl)-17-oxa-14-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12,14-octaene |
| SMILES | [2H]c1c2ccccc2cc2c1oc1c(-c3cc(C)cc(C)c3)nccc12 |
| InChI | InChI=1S/C23H17NO/c1-14-9-15(2)11-18(10-14)22-23-19(7-8-24-22)20-12-16-5-3-4-6-17(16)13-21(20)25-23/h3-13H,1-2H3/i13D |
| InChIKey | XWFKEKRKGOXHRA-YSOHJTORSA-N |
| XLogP | 6.42 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |