C21H22GeN2O — CID 166018646
[6-(3,5-dimethylphenyl)-8-oxa-5,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]-trimethylgermane (PubChem CID 166018646) has the molecular formula C21H22GeN2O and a molecular weight of 391.03 g/mol. Its IUPAC name is [6-(3,5-dimethylphenyl)-8-oxa-5,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]-trimethylgermane.
| Compound Name | [6-(3,5-dimethylphenyl)-8-oxa-5,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]-trimethylgermane |
|---|---|
| PubChem CID | 166018646 |
| Molecular Formula | C21H22GeN2O |
| Molecular Weight | 391.03 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | [6-(3,5-dimethylphenyl)-8-oxa-5,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]-trimethylgermane |
| SMILES | Cc1cc(C)cc(-c2nccc3c2oc2nc([Ge](C)(C)C)ccc23)c1 |
| InChI | InChI=1S/C21H22GeN2O/c1-13-10-14(2)12-15(11-13)19-20-16(8-9-23-19)17-6-7-18(22(3,4)5)24-21(17)25-20/h6-12H,1-5H3 |
| InChIKey | JWZZTVNJXUKCRQ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.03 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |