About N-[(4,4-difluorocyclohexyl)methyl]-4-(trifluoromethyl)piperidine-4-carboxamide
N-[(4,4-difluorocyclohexyl)methyl]-4-(trifluoromethyl)piperidine-4-carboxamide (PubChem CID 176759497) has the molecular formula C14H21F5N2O
and a molecular weight of 328.33 g/mol. Its IUPAC name is N-[(4,4-difluorocyclohexyl)methyl]-4-(trifluoromethyl)piperidine-4-carboxamide.
Molecular Properties
| Compound Name | N-[(4,4-difluorocyclohexyl)methyl]-4-(trifluoromethyl)piperidine-4-carboxamide |
| PubChem CID | 176759497 |
| Molecular Formula | C14H21F5N2O |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | N-[(4,4-difluorocyclohexyl)methyl]-4-(trifluoromethyl)piperidine-4-carboxamide |
| SMILES | O=C(NCC1CCC(F)(F)CC1)C1(C(F)(F)F)CCNCC1 |
| InChI | InChI=1S/C14H21F5N2O/c15-13(16)3-1-10(2-4-13)9-21-11(22)12(14(17,18)19)5-7-20-8-6-12/h10,20H,1-9H2,(H,21,22) |
| InChIKey | CHKCTCJYEJGTMU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(4,4-difluorocyclohexyl)methyl]-4-(trifluoromethyl)piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4,4-difluorocyclohexyl)methyl]-4-(trifluoromethyl)piperidine-4-carboxamide?
The IUPAC name of N-[(4,4-difluorocyclohexyl)methyl]-4-(trifluoromethyl)piperidine-4-carboxamide (CID 176759497) is N-[(4,4-difluorocyclohexyl)methyl]-4-(trifluoromethyl)piperidine-4-carboxamide.
What is the SMILES notation for N-[(4,4-difluorocyclohexyl)methyl]-4-(trifluoromethyl)piperidine-4-carboxamide?
The canonical SMILES for N-[(4,4-difluorocyclohexyl)methyl]-4-(trifluoromethyl)piperidine-4-carboxamide is O=C(NCC1CCC(F)(F)CC1)C1(C(F)(F)F)CCNCC1.
What is the InChIKey of N-[(4,4-difluorocyclohexyl)methyl]-4-(trifluoromethyl)piperidine-4-carboxamide?
The InChIKey is CHKCTCJYEJGTMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21F5N2O/c15-13(16)3-1-10(2-4-13)9-21-11(22)12(14(17,18)19)5-7-20-8-6-12/h10,20H,1-9H2,(H,21,22).
What are the key properties of N-[(4,4-difluorocyclohexyl)methyl]-4-(trifluoromethyl)piperidine-4-carboxamide?
N-[(4,4-difluorocyclohexyl)methyl]-4-(trifluoromethyl)piperidine-4-carboxamide has a molecular weight of 328.33 g/mol, XLogP of 2.86, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4,4-difluorocyclohexyl)methyl]-4-(trifluoromethyl)piperidine-4-carboxamide is sourced from PubChem (CID 176759497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).