C10H18F2N2O2 — CID 139389099
2-[(4,4-difluorocyclohexyl)methylamino]ethylcarbamic acid (PubChem CID 139389099) has the molecular formula C10H18F2N2O2 and a molecular weight of 236.26 g/mol. Its IUPAC name is 2-[(4,4-difluorocyclohexyl)methylamino]ethylcarbamic acid.
| Compound Name | 2-[(4,4-difluorocyclohexyl)methylamino]ethylcarbamic acid |
|---|---|
| PubChem CID | 139389099 |
| Molecular Formula | C10H18F2N2O2 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 2-[(4,4-difluorocyclohexyl)methylamino]ethylcarbamic acid |
| SMILES | O=C(O)NCCNCC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C10H18F2N2O2/c11-10(12)3-1-8(2-4-10)7-13-5-6-14-9(15)16/h8,13-14H,1-7H2,(H,15,16) |
| InChIKey | IJBAHQFBNHRQEZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|