C17H24N2O4S — CID 176760437
tert-butyl N-[2-(4-isocyanothiophen-2-yl)ethyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 176760437) has the molecular formula C17H24N2O4S and a molecular weight of 352.46 g/mol. Its IUPAC name is tert-butyl N-[2-(4-isocyanothiophen-2-yl)ethyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
| Compound Name | tert-butyl N-[2-(4-isocyanothiophen-2-yl)ethyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 176760437 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | tert-butyl N-[2-(4-isocyanothiophen-2-yl)ethyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | [C-]#[N+]c1csc(CCN(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C17H24N2O4S/c1-16(2,3)22-14(20)19(15(21)23-17(4,5)6)9-8-13-10-12(18-7)11-24-13/h10-11H,8-9H2,1-6H3 |
| InChIKey | IGKNOFYIEONZOK-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 60.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|