C15H25NO2S — CID 114749403
tert-butyl N-(5-hexylthiophen-3-yl)carbamate (PubChem CID 114749403) has the molecular formula C15H25NO2S and a molecular weight of 283.44 g/mol. Its IUPAC name is tert-butyl N-(5-hexylthiophen-3-yl)carbamate.
| Compound Name | tert-butyl N-(5-hexylthiophen-3-yl)carbamate |
|---|---|
| PubChem CID | 114749403 |
| Molecular Formula | C15H25NO2S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | tert-butyl N-(5-hexylthiophen-3-yl)carbamate |
| SMILES | CCCCCCc1cc(NC(=O)OC(C)(C)C)cs1 |
| InChI | InChI=1S/C15H25NO2S/c1-5-6-7-8-9-13-10-12(11-19-13)16-14(17)18-15(2,3)4/h10-11H,5-9H2,1-4H3,(H,16,17) |
| InChIKey | ALCFILPVVVCXIJ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|