C29H27ClFNO — CID 176763045
9-chloro-7-(4-fluoro-2,6-dimethylphenyl)-1,16-dimethyl-11-azapentacyclo[14.2.2.02,14.04,12.05,10]icosa-2(14),3,5(10),6,8,12-hexaen-15-one (PubChem CID 176763045) has the molecular formula C29H27ClFNO and a molecular weight of 459.99 g/mol. Its IUPAC name is 9-chloro-7-(4-fluoro-2,6-dimethylphenyl)-1,16-dimethyl-11-azapentacyclo[14.2.2.02,14.04,12.05,10]icosa-2(14),3,5(10),6,8,12-hexaen-15-one.
| Compound Name | 9-chloro-7-(4-fluoro-2,6-dimethylphenyl)-1,16-dimethyl-11-azapentacyclo[14.2.2.02,14.04,12.05,10]icosa-2(14),3,5(10),6,8,12-hexaen-15-one |
|---|---|
| PubChem CID | 176763045 |
| Molecular Formula | C29H27ClFNO |
| Molecular Weight | 459.99 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 9-chloro-7-(4-fluoro-2,6-dimethylphenyl)-1,16-dimethyl-11-azapentacyclo[14.2.2.02,14.04,12.05,10]icosa-2(14),3,5(10),6,8,12-hexaen-15-one |
| SMILES | Cc1cc(F)cc(C)c1-c1cc(Cl)c2[nH]c3cc4c(cc3c2c1)C1(C)CCC(C)(CC1)C4=O |
| InChI | InChI=1S/C29H27ClFNO/c1-15-9-18(31)10-16(2)25(15)17-11-20-19-13-22-21(14-24(19)32-26(20)23(30)12-17)27(33)29(4)7-5-28(22,3)6-8-29/h9-14,32H,5-8H2,1-4H3 |
| InChIKey | VYDGTOQNXRUHGY-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.99 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |