C21H16ClNO — CID 71699443
(6-chloro-1,4-dimethyl-9H-carbazol-3-yl)-phenylmethanone (PubChem CID 71699443) has the molecular formula C21H16ClNO and a molecular weight of 333.82 g/mol. Its IUPAC name is (6-chloro-1,4-dimethyl-9H-carbazol-3-yl)-phenylmethanone.
| Compound Name | (6-chloro-1,4-dimethyl-9H-carbazol-3-yl)-phenylmethanone |
|---|---|
| PubChem CID | 71699443 |
| Molecular Formula | C21H16ClNO |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | (6-chloro-1,4-dimethyl-9H-carbazol-3-yl)-phenylmethanone |
| SMILES | Cc1cc(C(=O)c2ccccc2)c(C)c2c1[nH]c1ccc(Cl)cc12 |
| InChI | InChI=1S/C21H16ClNO/c1-12-10-16(21(24)14-6-4-3-5-7-14)13(2)19-17-11-15(22)8-9-18(17)23-20(12)19/h3-11,23H,1-2H3 |
| InChIKey | ABQGFWHJYDCYDD-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |