About (6-chloro-3-methyl-9H-[1,2]dioxino[3,4-b]indol-4-yl)-phenylmethanone
(6-chloro-3-methyl-9H-[1,2]dioxino[3,4-b]indol-4-yl)-phenylmethanone (PubChem CID 135264275) has the molecular formula C18H12ClNO3
and a molecular weight of 325.75 g/mol. Its IUPAC name is (6-chloro-3-methyl-9H-[1,2]dioxino[3,4-b]indol-4-yl)-phenylmethanone.
Molecular Properties
| Compound Name | (6-chloro-3-methyl-9H-[1,2]dioxino[3,4-b]indol-4-yl)-phenylmethanone |
| PubChem CID | 135264275 |
| Molecular Formula | C18H12ClNO3 |
| Molecular Weight | 325.75 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | (6-chloro-3-methyl-9H-[1,2]dioxino[3,4-b]indol-4-yl)-phenylmethanone |
| SMILES | CC1=C(C(=O)c2ccccc2)c2c([nH]c3ccc(Cl)cc23)OO1 |
| InChI | InChI=1S/C18H12ClNO3/c1-10-15(17(21)11-5-3-2-4-6-11)16-13-9-12(19)7-8-14(13)20-18(16)23-22-10/h2-9,20H,1H3 |
| InChIKey | RXBCERCYOSYWGC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.75 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (6-chloro-3-methyl-9H-[1,2]dioxino[3,4-b]indol-4-yl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-3-methyl-9H-[1,2]dioxino[3,4-b]indol-4-yl)-phenylmethanone?
The IUPAC name of (6-chloro-3-methyl-9H-[1,2]dioxino[3,4-b]indol-4-yl)-phenylmethanone (CID 135264275) is (6-chloro-3-methyl-9H-[1,2]dioxino[3,4-b]indol-4-yl)-phenylmethanone.
What is the SMILES notation for (6-chloro-3-methyl-9H-[1,2]dioxino[3,4-b]indol-4-yl)-phenylmethanone?
The canonical SMILES for (6-chloro-3-methyl-9H-[1,2]dioxino[3,4-b]indol-4-yl)-phenylmethanone is CC1=C(C(=O)c2ccccc2)c2c([nH]c3ccc(Cl)cc23)OO1.
What is the InChIKey of (6-chloro-3-methyl-9H-[1,2]dioxino[3,4-b]indol-4-yl)-phenylmethanone?
The InChIKey is RXBCERCYOSYWGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12ClNO3/c1-10-15(17(21)11-5-3-2-4-6-11)16-13-9-12(19)7-8-14(13)20-18(16)23-22-10/h2-9,20H,1H3.
What are the key properties of (6-chloro-3-methyl-9H-[1,2]dioxino[3,4-b]indol-4-yl)-phenylmethanone?
(6-chloro-3-methyl-9H-[1,2]dioxino[3,4-b]indol-4-yl)-phenylmethanone has a molecular weight of 325.75 g/mol, XLogP of 4.76, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-3-methyl-9H-[1,2]dioxino[3,4-b]indol-4-yl)-phenylmethanone is sourced from PubChem (CID 135264275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).