C18H12ClNO3 — CID 135264275
(6-chloro-3-methyl-9H-[1,2]dioxino[3,4-b]indol-4-yl)-phenylmethanone (PubChem CID 135264275) has the molecular formula C18H12ClNO3 and a molecular weight of 325.75 g/mol. Its IUPAC name is (6-chloro-3-methyl-9H-[1,2]dioxino[3,4-b]indol-4-yl)-phenylmethanone.
| Compound Name | (6-chloro-3-methyl-9H-[1,2]dioxino[3,4-b]indol-4-yl)-phenylmethanone |
|---|---|
| PubChem CID | 135264275 |
| Molecular Formula | C18H12ClNO3 |
| Molecular Weight | 325.75 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | (6-chloro-3-methyl-9H-[1,2]dioxino[3,4-b]indol-4-yl)-phenylmethanone |
| SMILES | CC1=C(C(=O)c2ccccc2)c2c([nH]c3ccc(Cl)cc23)OO1 |
| InChI | InChI=1S/C18H12ClNO3/c1-10-15(17(21)11-5-3-2-4-6-11)16-13-9-12(19)7-8-14(13)20-18(16)23-22-10/h2-9,20H,1H3 |
| InChIKey | RXBCERCYOSYWGC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.75 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|