C18H11ClN2O — CID 66765937
(3-chloro-9H-pyrido[2,3-b]indol-6-yl)-phenylmethanone (PubChem CID 66765937) has the molecular formula C18H11ClN2O and a molecular weight of 306.75 g/mol. Its IUPAC name is (3-chloro-9H-pyrido[2,3-b]indol-6-yl)-phenylmethanone.
| Compound Name | (3-chloro-9H-pyrido[2,3-b]indol-6-yl)-phenylmethanone |
|---|---|
| PubChem CID | 66765937 |
| Molecular Formula | C18H11ClN2O |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | (3-chloro-9H-pyrido[2,3-b]indol-6-yl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccc2[nH]c3ncc(Cl)cc3c2c1 |
| InChI | InChI=1S/C18H11ClN2O/c19-13-9-15-14-8-12(17(22)11-4-2-1-3-5-11)6-7-16(14)21-18(15)20-10-13/h1-10H,(H,20,21) |
| InChIKey | IGJAVXWFLIKKGV-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |