C16H15ClN2O2S — CID 46185917
1-(3-chloro-9H-pyrido[2,3-b]indol-6-yl)-2-(3-hydroxypropylsulfanyl)ethanone (PubChem CID 46185917) has the molecular formula C16H15ClN2O2S and a molecular weight of 334.83 g/mol. Its IUPAC name is 1-(3-chloro-9H-pyrido[2,3-b]indol-6-yl)-2-(3-hydroxypropylsulfanyl)ethanone.
| Compound Name | 1-(3-chloro-9H-pyrido[2,3-b]indol-6-yl)-2-(3-hydroxypropylsulfanyl)ethanone |
|---|---|
| PubChem CID | 46185917 |
| Molecular Formula | C16H15ClN2O2S |
| Molecular Weight | 334.83 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 1-(3-chloro-9H-pyrido[2,3-b]indol-6-yl)-2-(3-hydroxypropylsulfanyl)ethanone |
| SMILES | O=C(CSCCCO)c1ccc2[nH]c3ncc(Cl)cc3c2c1 |
| InChI | InChI=1S/C16H15ClN2O2S/c17-11-7-13-12-6-10(15(21)9-22-5-1-4-20)2-3-14(12)19-16(13)18-8-11/h2-3,6-8,20H,1,4-5,9H2,(H,18,19) |
| InChIKey | WBYZOBUZFMPXCQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.83 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|