C21H17ClN2O2S — CID 46185657
1-(3-chloro-9H-pyrido[2,3-b]indol-6-yl)-2-(2-phenoxyethylsulfanyl)ethanone (PubChem CID 46185657) has the molecular formula C21H17ClN2O2S and a molecular weight of 396.90 g/mol. Its IUPAC name is 1-(3-chloro-9H-pyrido[2,3-b]indol-6-yl)-2-(2-phenoxyethylsulfanyl)ethanone.
| Compound Name | 1-(3-chloro-9H-pyrido[2,3-b]indol-6-yl)-2-(2-phenoxyethylsulfanyl)ethanone |
|---|---|
| PubChem CID | 46185657 |
| Molecular Formula | C21H17ClN2O2S |
| Molecular Weight | 396.90 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 1-(3-chloro-9H-pyrido[2,3-b]indol-6-yl)-2-(2-phenoxyethylsulfanyl)ethanone |
| SMILES | O=C(CSCCOc1ccccc1)c1ccc2[nH]c3ncc(Cl)cc3c2c1 |
| InChI | InChI=1S/C21H17ClN2O2S/c22-15-11-18-17-10-14(6-7-19(17)24-21(18)23-12-15)20(25)13-27-9-8-26-16-4-2-1-3-5-16/h1-7,10-12H,8-9,13H2,(H,23,24) |
| InChIKey | PYYVUZXYENEBKL-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.90 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|