C19H22ClN3OS — CID 66766248
1-(3-chloro-9H-pyrido[2,3-b]indol-6-yl)-2-[1-(diethylamino)ethylsulfanyl]ethanone (PubChem CID 66766248) has the molecular formula C19H22ClN3OS and a molecular weight of 375.93 g/mol. Its IUPAC name is 1-(3-chloro-9H-pyrido[2,3-b]indol-6-yl)-2-[1-(diethylamino)ethylsulfanyl]ethanone.
| Compound Name | 1-(3-chloro-9H-pyrido[2,3-b]indol-6-yl)-2-[1-(diethylamino)ethylsulfanyl]ethanone |
|---|---|
| PubChem CID | 66766248 |
| Molecular Formula | C19H22ClN3OS |
| Molecular Weight | 375.93 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 1-(3-chloro-9H-pyrido[2,3-b]indol-6-yl)-2-[1-(diethylamino)ethylsulfanyl]ethanone |
| SMILES | CCN(CC)C(C)SCC(=O)c1ccc2[nH]c3ncc(Cl)cc3c2c1 |
| InChI | InChI=1S/C19H22ClN3OS/c1-4-23(5-2)12(3)25-11-18(24)13-6-7-17-15(8-13)16-9-14(20)10-21-19(16)22-17/h6-10,12H,4-5,11H2,1-3H3,(H,21,22) |
| InChIKey | MVKNBMBGCHJROZ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.93 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|