C29H47N3O8 — CID 176769454
prop-2-enyl 3-[2-[2-[bis(3-oxo-3-prop-2-enoxypropyl)amino]ethyl-methylamino]ethyl-(3-oxo-3-prop-2-enoxypropyl)amino]propanoate (PubChem CID 176769454) has the molecular formula C29H47N3O8 and a molecular weight of 565.71 g/mol. Its IUPAC name is prop-2-enyl 3-[2-[2-[bis(3-oxo-3-prop-2-enoxypropyl)amino]ethyl-methylamino]ethyl-(3-oxo-3-prop-2-enoxypropyl)amino]propanoate.
| Compound Name | prop-2-enyl 3-[2-[2-[bis(3-oxo-3-prop-2-enoxypropyl)amino]ethyl-methylamino]ethyl-(3-oxo-3-prop-2-enoxypropyl)amino]propanoate |
|---|---|
| PubChem CID | 176769454 |
| Molecular Formula | C29H47N3O8 |
| Molecular Weight | 565.71 g/mol |
| Exact Mass | 565.34 |
| IUPAC Name | prop-2-enyl 3-[2-[2-[bis(3-oxo-3-prop-2-enoxypropyl)amino]ethyl-methylamino]ethyl-(3-oxo-3-prop-2-enoxypropyl)amino]propanoate |
| SMILES | C=CCOC(=O)CCN(CCC(=O)OCC=C)CCN(C)CCN(CCC(=O)OCC=C)CCC(=O)OCC=C |
| InChI | InChI=1S/C29H47N3O8/c1-6-22-37-26(33)10-14-31(15-11-27(34)38-23-7-2)20-18-30(5)19-21-32(16-12-28(35)39-24-8-3)17-13-29(36)40-25-9-4/h6-9H,1-4,10-25H2,5H3 |
| InChIKey | CQAWHHAZGULBFW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 114.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.71 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|