C8H18N2O6S — CID 87301528
prop-2-enyl 3-(2,2-dimethylhydrazinyl)propanoate;sulfuric acid (PubChem CID 87301528) has the molecular formula C8H18N2O6S and a molecular weight of 270.31 g/mol. Its IUPAC name is prop-2-enyl 3-(2,2-dimethylhydrazinyl)propanoate;sulfuric acid.
| Compound Name | prop-2-enyl 3-(2,2-dimethylhydrazinyl)propanoate;sulfuric acid |
|---|---|
| PubChem CID | 87301528 |
| Molecular Formula | C8H18N2O6S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | prop-2-enyl 3-(2,2-dimethylhydrazinyl)propanoate;sulfuric acid |
| SMILES | C=CCOC(=O)CCNN(C)C.O=S(=O)(O)O |
| InChI | InChI=1S/C8H16N2O2.H2O4S/c1-4-7-12-8(11)5-6-9-10(2)3;1-5(2,3)4/h4,9H,1,5-7H2,2-3H3;(H2,1,2,3,4) |
| InChIKey | BAYHMBDYCNEMQQ-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|