C19H17F6N5O — CID 176769670
trans-(1S,2S)-2-[[1-[2,4-bis(trifluoromethyl)phenyl]imidazo[1,5-d][1,2,4]triazin-4-yl]amino]cyclohexan-1-ol (PubChem CID 176769670) has the molecular formula C19H17F6N5O and a molecular weight of 445.37 g/mol. Its IUPAC name is trans-(1S,2S)-2-[[1-[2,4-bis(trifluoromethyl)phenyl]imidazo[1,5-d][1,2,4]triazin-4-yl]amino]cyclohexan-1-ol.
| Compound Name | trans-(1S,2S)-2-[[1-[2,4-bis(trifluoromethyl)phenyl]imidazo[1,5-d][1,2,4]triazin-4-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 176769670 |
| Molecular Formula | C19H17F6N5O |
| Molecular Weight | 445.37 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | trans-(1S,2S)-2-[[1-[2,4-bis(trifluoromethyl)phenyl]imidazo[1,5-d][1,2,4]triazin-4-yl]amino]cyclohexan-1-ol |
| SMILES | O[C@H]1CCCC[C@@H]1Nc1nnc(-c2ccc(C(F)(F)F)cc2C(F)(F)F)c2cncn12 |
| InChI | InChI=1S/C19H17F6N5O/c20-18(21,22)10-5-6-11(12(7-10)19(23,24)25)16-14-8-26-9-30(14)17(29-28-16)27-13-3-1-2-4-15(13)31/h5-9,13,15,31H,1-4H2,(H,27,29)/t13-,15-/m0/s1 |
| InChIKey | SXJCRCFFRYDLPB-ZFWWWQNUSA-N |
| XLogP | 4.54 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.37 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |