C29H33O2S+ — CID 176774424
[4-(2-adamantyloxymethoxy)cyclohexa-1,3-dien-1-yl]-diphenylsulfanium (PubChem CID 176774424) has the molecular formula C29H33O2S+ and a molecular weight of 445.65 g/mol. Its IUPAC name is [4-(2-adamantyloxymethoxy)cyclohexa-1,3-dien-1-yl]-diphenylsulfanium.
| Compound Name | [4-(2-adamantyloxymethoxy)cyclohexa-1,3-dien-1-yl]-diphenylsulfanium |
|---|---|
| PubChem CID | 176774424 |
| Molecular Formula | C29H33O2S+ |
| Molecular Weight | 445.65 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | [4-(2-adamantyloxymethoxy)cyclohexa-1,3-dien-1-yl]-diphenylsulfanium |
| SMILES | C1=C(OCOC2C3CC4CC(C3)CC2C4)CCC([S+](c2ccccc2)c2ccccc2)=C1 |
| InChI | InChI=1S/C29H33O2S/c1-3-7-26(8-4-1)32(27-9-5-2-6-10-27)28-13-11-25(12-14-28)30-20-31-29-23-16-21-15-22(18-23)19-24(29)17-21/h1-11,13,21-24,29H,12,14-20H2/q+1 |
| InChIKey | DKRZCBAGWUOEJL-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.65 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|