C31H39O2S+ — CID 176774431
[(3Z,5Z)-5-(2-adamantyloxymethoxy)-4-methylhepta-1,3,5-trien-2-yl]-cyclohexa-2,4-dien-1-yl-phenylsulfanium (PubChem CID 176774431) has the molecular formula C31H39O2S+ and a molecular weight of 475.72 g/mol. Its IUPAC name is [(3Z,5Z)-5-(2-adamantyloxymethoxy)-4-methylhepta-1,3,5-trien-2-yl]-cyclohexa-2,4-dien-1-yl-phenylsulfanium.
| Compound Name | [(3Z,5Z)-5-(2-adamantyloxymethoxy)-4-methylhepta-1,3,5-trien-2-yl]-cyclohexa-2,4-dien-1-yl-phenylsulfanium |
|---|---|
| PubChem CID | 176774431 |
| Molecular Formula | C31H39O2S+ |
| Molecular Weight | 475.72 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | [(3Z,5Z)-5-(2-adamantyloxymethoxy)-4-methylhepta-1,3,5-trien-2-yl]-cyclohexa-2,4-dien-1-yl-phenylsulfanium |
| SMILES | C=C(/C=C(C)\C(=C\C)OCOC1C2CC3CC(C2)CC1C3)[S+](c1ccccc1)C1C=CC=CC1 |
| InChI | InChI=1S/C31H39O2S/c1-4-30(32-21-33-31-26-17-24-16-25(19-26)20-27(31)18-24)22(2)15-23(3)34(28-11-7-5-8-12-28)29-13-9-6-10-14-29/h4-13,15,24-27,29,31H,3,14,16-21H2,1-2H3/q+1/b22-15-,30-4- |
| InChIKey | CZUHGMGBCWNSNZ-WZRAQQAXSA-N |
| XLogP | 7.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.72 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|