C19H24O2S — CID 101341050
(4R)-4-(phenylsulfanylmethyl)spiro[1,3-dioxolane-2,2'-adamantane] (PubChem CID 101341050) has the molecular formula C19H24O2S and a molecular weight of 316.47 g/mol. Its IUPAC name is (4R)-4-(phenylsulfanylmethyl)spiro[1,3-dioxolane-2,2'-adamantane].
| Compound Name | (4R)-4-(phenylsulfanylmethyl)spiro[1,3-dioxolane-2,2'-adamantane] |
|---|---|
| PubChem CID | 101341050 |
| Molecular Formula | C19H24O2S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | (4R)-4-(phenylsulfanylmethyl)spiro[1,3-dioxolane-2,2'-adamantane] |
| SMILES | c1ccc(SC[C@H]2COC3(O2)C2CC4CC(C2)CC3C4)cc1 |
| InChI | InChI=1S/C19H24O2S/c1-2-4-18(5-3-1)22-12-17-11-20-19(21-17)15-7-13-6-14(9-15)10-16(19)8-13/h1-5,13-17H,6-12H2/t13?,14?,15?,16?,17-,19?/m1/s1 |
| InChIKey | RIWHNZDWLHPODV-CMPFZWEDSA-N |
| XLogP | 4.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |