C14H19NO4 — CID 176776210
benzyl 5,5-dideuterio-3-methoxy-1,4-oxazepane-4-carboxylate (PubChem CID 176776210) has the molecular formula C14H19NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is benzyl 5,5-dideuterio-3-methoxy-1,4-oxazepane-4-carboxylate.
| Compound Name | benzyl 5,5-dideuterio-3-methoxy-1,4-oxazepane-4-carboxylate |
|---|---|
| PubChem CID | 176776210 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | benzyl 5,5-dideuterio-3-methoxy-1,4-oxazepane-4-carboxylate |
| SMILES | [2H]C1([2H])CCOCC(OC)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H19NO4/c1-17-13-11-18-9-5-8-15(13)14(16)19-10-12-6-3-2-4-7-12/h2-4,6-7,13H,5,8-11H2,1H3/i8D2 |
| InChIKey | WYDRIEZOGQEHNZ-MGVXTIMCSA-N |
| XLogP | 2.02 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |