C13H21N — CID 176776717
2,6-bis(dideuteriomethylidene)-8-(2-methylpropyl)-1,3,5,7-tetrahydropyrrolizine (PubChem CID 176776717) has the molecular formula C13H21N and a molecular weight of 195.34 g/mol. Its IUPAC name is 2,6-bis(dideuteriomethylidene)-8-(2-methylpropyl)-1,3,5,7-tetrahydropyrrolizine.
| Compound Name | 2,6-bis(dideuteriomethylidene)-8-(2-methylpropyl)-1,3,5,7-tetrahydropyrrolizine |
|---|---|
| PubChem CID | 176776717 |
| Molecular Formula | C13H21N |
| Molecular Weight | 195.34 g/mol |
| Exact Mass | 195.19 |
| IUPAC Name | 2,6-bis(dideuteriomethylidene)-8-(2-methylpropyl)-1,3,5,7-tetrahydropyrrolizine |
| SMILES | [2H]C([2H])=C1CN2CC(=C([2H])[2H])CC2(CC(C)C)C1 |
| InChI | InChI=1S/C13H21N/c1-10(2)5-13-6-11(3)8-14(13)9-12(4)7-13/h10H,3-9H2,1-2H3/i3D2,4D2 |
| InChIKey | SVIDDCTWLIGRNR-KHORGVISSA-N |
| XLogP | 2.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|