C26H24BNO3 — CID 176780559
6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-[1]benzofuro[2,3-b]indole (PubChem CID 176780559) has the molecular formula C26H24BNO3 and a molecular weight of 409.29 g/mol. Its IUPAC name is 6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-[1]benzofuro[2,3-b]indole.
| Compound Name | 6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-[1]benzofuro[2,3-b]indole |
|---|---|
| PubChem CID | 176780559 |
| Molecular Formula | C26H24BNO3 |
| Molecular Weight | 409.29 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-[1]benzofuro[2,3-b]indole |
| SMILES | CC1(C)OB(c2cccc(-n3c4ccccc4c4c5ccccc5oc43)c2)OC1(C)C |
| InChI | InChI=1S/C26H24BNO3/c1-25(2)26(3,4)31-27(30-25)17-10-9-11-18(16-17)28-21-14-7-5-12-19(21)23-20-13-6-8-15-22(20)29-24(23)28/h5-16H,1-4H3 |
| InChIKey | DEXJWHDNDVAOCJ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 36.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.29 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|