C24H34O8S — CID 176800613
2-[2-(4-butan-2-ylsulfonylphenoxy)ethoxy]-3,4-dimethoxy-1,5-bis(methoxymethyl)benzene (PubChem CID 176800613) has the molecular formula C24H34O8S and a molecular weight of 482.60 g/mol. Its IUPAC name is 2-[2-(4-butan-2-ylsulfonylphenoxy)ethoxy]-3,4-dimethoxy-1,5-bis(methoxymethyl)benzene.
| Compound Name | 2-[2-(4-butan-2-ylsulfonylphenoxy)ethoxy]-3,4-dimethoxy-1,5-bis(methoxymethyl)benzene |
|---|---|
| PubChem CID | 176800613 |
| Molecular Formula | C24H34O8S |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 2-[2-(4-butan-2-ylsulfonylphenoxy)ethoxy]-3,4-dimethoxy-1,5-bis(methoxymethyl)benzene |
| SMILES | CCC(C)S(=O)(=O)c1ccc(OCCOc2c(COC)cc(COC)c(OC)c2OC)cc1 |
| InChI | InChI=1S/C24H34O8S/c1-7-17(2)33(25,26)21-10-8-20(9-11-21)31-12-13-32-23-19(16-28-4)14-18(15-27-3)22(29-5)24(23)30-6/h8-11,14,17H,7,12-13,15-16H2,1-6H3 |
| InChIKey | MYANKJWOAUKGEB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|