C43H60O6 — CID 159281825
3-butan-2-ylphenol;4-butan-2-ylphenol;2-[2-(4-butan-2-ylphenoxy)ethoxy]-1,3-bis(methoxymethyl)-5-methylbenzene (PubChem CID 159281825) has the molecular formula C43H60O6 and a molecular weight of 672.95 g/mol. Its IUPAC name is 3-butan-2-ylphenol;4-butan-2-ylphenol;2-[2-(4-butan-2-ylphenoxy)ethoxy]-1,3-bis(methoxymethyl)-5-methylbenzene.
| Compound Name | 3-butan-2-ylphenol;4-butan-2-ylphenol;2-[2-(4-butan-2-ylphenoxy)ethoxy]-1,3-bis(methoxymethyl)-5-methylbenzene |
|---|---|
| PubChem CID | 159281825 |
| Molecular Formula | C43H60O6 |
| Molecular Weight | 672.95 g/mol |
| Exact Mass | 672.44 |
| IUPAC Name | 3-butan-2-ylphenol;4-butan-2-ylphenol;2-[2-(4-butan-2-ylphenoxy)ethoxy]-1,3-bis(methoxymethyl)-5-methylbenzene |
| SMILES | CCC(C)c1ccc(O)cc1.CCC(C)c1ccc(OCCOc2c(COC)cc(C)cc2COC)cc1.CCC(C)c1cccc(O)c1 |
| InChI | InChI=1S/C23H32O4.2C10H14O/c1-6-18(3)19-7-9-22(10-8-19)26-11-12-27-23-20(15-24-4)13-17(2)14-21(23)16-25-5;1-3-8(2)9-4-6-10(11)7-5-9;1-3-8(2)9-5-4-6-10(11)7-9/h7-10,13-14,18H,6,11-12,15-16H2,1-5H3;2*4-8,11H,3H2,1-2H3 |
| InChIKey | KYZVWJALBUSZIZ-UHFFFAOYSA-N |
| XLogP | 11.07 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.95 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|