C14H24O2 — CID 145144521
4-butan-2-yl-2-(methoxymethyl)phenol;ethane (PubChem CID 145144521) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 4-butan-2-yl-2-(methoxymethyl)phenol;ethane.
| Compound Name | 4-butan-2-yl-2-(methoxymethyl)phenol;ethane |
|---|---|
| PubChem CID | 145144521 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 4-butan-2-yl-2-(methoxymethyl)phenol;ethane |
| SMILES | CC.CCC(C)c1ccc(O)c(COC)c1 |
| InChI | InChI=1S/C12H18O2.C2H6/c1-4-9(2)10-5-6-12(13)11(7-10)8-14-3;1-2/h5-7,9,13H,4,8H2,1-3H3;1-2H3 |
| InChIKey | IXOMGADKNWEMCH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |