C38H54O7 — CID 123395177
4-[3,5-bis(methoxymethyl)-4-[2-[4-(2,2,5,5-tetramethylhexan-3-yl)phenoxy]ethoxy]phenyl]-2,6-bis(methoxymethyl)phenol (PubChem CID 123395177) has the molecular formula C38H54O7 and a molecular weight of 622.84 g/mol. Its IUPAC name is 4-[3,5-bis(methoxymethyl)-4-[2-[4-(2,2,5,5-tetramethylhexan-3-yl)phenoxy]ethoxy]phenyl]-2,6-bis(methoxymethyl)phenol.
| Compound Name | 4-[3,5-bis(methoxymethyl)-4-[2-[4-(2,2,5,5-tetramethylhexan-3-yl)phenoxy]ethoxy]phenyl]-2,6-bis(methoxymethyl)phenol |
|---|---|
| PubChem CID | 123395177 |
| Molecular Formula | C38H54O7 |
| Molecular Weight | 622.84 g/mol |
| Exact Mass | 622.39 |
| IUPAC Name | 4-[3,5-bis(methoxymethyl)-4-[2-[4-(2,2,5,5-tetramethylhexan-3-yl)phenoxy]ethoxy]phenyl]-2,6-bis(methoxymethyl)phenol |
| SMILES | COCc1cc(-c2cc(COC)c(OCCOc3ccc(C(CC(C)(C)C)C(C)(C)C)cc3)c(COC)c2)cc(COC)c1O |
| InChI | InChI=1S/C38H54O7/c1-37(2,3)21-34(38(4,5)6)26-11-13-33(14-12-26)44-15-16-45-36-31(24-42-9)19-28(20-32(36)25-43-10)27-17-29(22-40-7)35(39)30(18-27)23-41-8/h11-14,17-20,34,39H,15-16,21-25H2,1-10H3 |
| InChIKey | REGZYQBLYLGUQO-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.84 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|