C18H25ClN4O5 — CID 176801655
tert-butyl (1R,5S)-3-[[6-[amino(chloro)methyl]-5-nitro-2-pyridinyl]oxy]-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 176801655) has the molecular formula C18H25ClN4O5 and a molecular weight of 412.87 g/mol. Its IUPAC name is tert-butyl (1R,5S)-3-[[6-[amino(chloro)methyl]-5-nitro-2-pyridinyl]oxy]-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl (1R,5S)-3-[[6-[amino(chloro)methyl]-5-nitro-2-pyridinyl]oxy]-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 176801655 |
| Molecular Formula | C18H25ClN4O5 |
| Molecular Weight | 412.87 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | tert-butyl (1R,5S)-3-[[6-[amino(chloro)methyl]-5-nitro-2-pyridinyl]oxy]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]1CC(Oc1ccc([N+](=O)[O-])c(C(N)Cl)n1)C2 |
| InChI | InChI=1S/C18H25ClN4O5/c1-18(2,3)28-17(24)22-10-4-5-11(22)9-12(8-10)27-14-7-6-13(23(25)26)15(21-14)16(19)20/h6-7,10-12,16H,4-5,8-9,20H2,1-3H3/t10-,11+,12?,16? |
| InChIKey | CNUYYXGIBBGBFA-FVGKDHOHSA-N |
| XLogP | 3.50 |
| TPSA | 120.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.87 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|