C26H21N2O+ — CID 176802320
4,5-dimethyl-6-(2-methylphenyl)-20-oxa-6-aza-4-azoniapentacyclo[11.7.0.02,10.03,7.014,19]icosa-1(13),2(10),3(7),4,8,11,14,16,18-nonaene (PubChem CID 176802320) has the molecular formula C26H21N2O+ and a molecular weight of 377.47 g/mol. Its IUPAC name is 4,5-dimethyl-6-(2-methylphenyl)-20-oxa-6-aza-4-azoniapentacyclo[11.7.0.02,10.03,7.014,19]icosa-1(13),2(10),3(7),4,8,11,14,16,18-nonaene.
| Compound Name | 4,5-dimethyl-6-(2-methylphenyl)-20-oxa-6-aza-4-azoniapentacyclo[11.7.0.02,10.03,7.014,19]icosa-1(13),2(10),3(7),4,8,11,14,16,18-nonaene |
|---|---|
| PubChem CID | 176802320 |
| Molecular Formula | C26H21N2O+ |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 4,5-dimethyl-6-(2-methylphenyl)-20-oxa-6-aza-4-azoniapentacyclo[11.7.0.02,10.03,7.014,19]icosa-1(13),2(10),3(7),4,8,11,14,16,18-nonaene |
| SMILES | Cc1ccccc1-n1c(C)[n+](C)c2c3c(ccc4c5ccccc5oc43)ccc21 |
| InChI | InChI=1S/C26H21N2O/c1-16-8-4-6-10-21(16)28-17(2)27(3)25-22(28)15-13-18-12-14-20-19-9-5-7-11-23(19)29-26(20)24(18)25/h4-15H,1-3H3/q+1 |
| InChIKey | WAUOOQPUEWOBSX-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 21.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|