C34H22BN2O4+ — CID 176802364
17,18-dimethyl-19-(3-methyldibenzofuran-4-yl)-8,14,25-trioxa-19-aza-17-azonia-1-boraheptacyclo[11.10.1.13,22.02,7.09,24.015,23.016,20]pentacosa-2(7),3,5,9(24),10,12,15,17,20,22-decaene (PubChem CID 176802364) has the molecular formula C34H22BN2O4+ and a molecular weight of 533.37 g/mol. Its IUPAC name is 17,18-dimethyl-19-(3-methyldibenzofuran-4-yl)-8,14,25-trioxa-19-aza-17-azonia-1-boraheptacyclo[11.10.1.13,22.02,7.09,24.015,23.016,20]pentacosa-2(7),3,5,9(24),10,12,15,17,20,22-decaene.
| Compound Name | 17,18-dimethyl-19-(3-methyldibenzofuran-4-yl)-8,14,25-trioxa-19-aza-17-azonia-1-boraheptacyclo[11.10.1.13,22.02,7.09,24.015,23.016,20]pentacosa-2(7),3,5,9(24),10,12,15,17,20,22-decaene |
|---|---|
| PubChem CID | 176802364 |
| Molecular Formula | C34H22BN2O4+ |
| Molecular Weight | 533.37 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | 17,18-dimethyl-19-(3-methyldibenzofuran-4-yl)-8,14,25-trioxa-19-aza-17-azonia-1-boraheptacyclo[11.10.1.13,22.02,7.09,24.015,23.016,20]pentacosa-2(7),3,5,9(24),10,12,15,17,20,22-decaene |
| SMILES | Cc1ccc2c(oc3ccccc32)c1-n1c(C)[n+](C)c2c3c4c(cc21)Oc1cccc2c1B4c1c(cccc1O3)O2 |
| InChI | InChI=1S/C34H22BN2O4/c1-17-14-15-20-19-8-4-5-9-22(19)40-33(20)31(17)37-18(2)36(3)32-21(37)16-27-30-34(32)41-26-13-7-11-24-29(26)35(30)28-23(38-24)10-6-12-25(28)39-27/h4-16H,1-3H3/q+1 |
| InChIKey | HCFGUAMVTWHDEL-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 49.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.37 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|